C13H11N3O4 — CID 79875212
1-(2,5-dimethoxyphenyl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 79875212) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2,4-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 79875212 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | COc1ccc(OC)c(-n2cc(C#N)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C13H11N3O4/c1-19-9-3-4-11(20-2)10(5-9)16-7-8(6-14)12(17)15-13(16)18/h3-5,7H,1-2H3,(H,15,17,18) |
| InChIKey | JCEMZNSXCFODBM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |