C12H5ClN4O2 — CID 20519644
1-(4-chloro-2-cyanophenyl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 20519644) has the molecular formula C12H5ClN4O2 and a molecular weight of 272.65 g/mol. Its IUPAC name is 1-(4-chloro-2-cyanophenyl)-2,4-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1-(4-chloro-2-cyanophenyl)-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 20519644 |
| Molecular Formula | C12H5ClN4O2 |
| Molecular Weight | 272.65 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 1-(4-chloro-2-cyanophenyl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | N#Cc1cc(Cl)ccc1-n1cc(C#N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H5ClN4O2/c13-9-1-2-10(7(3-9)4-14)17-6-8(5-15)11(18)16-12(17)19/h1-3,6H,(H,16,18,19) |
| InChIKey | OZMUXFQFUJCZLC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.65 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |