C11H5BrIN3O2 — CID 114261384
1-(5-bromo-2-iodophenyl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 114261384) has the molecular formula C11H5BrIN3O2 and a molecular weight of 417.99 g/mol. Its IUPAC name is 1-(5-bromo-2-iodophenyl)-2,4-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1-(5-bromo-2-iodophenyl)-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 114261384 |
| Molecular Formula | C11H5BrIN3O2 |
| Molecular Weight | 417.99 g/mol |
| Exact Mass | 416.86 |
| IUPAC Name | 1-(5-bromo-2-iodophenyl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | N#Cc1cn(-c2cc(Br)ccc2I)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H5BrIN3O2/c12-7-1-2-8(13)9(3-7)16-5-6(4-14)10(17)15-11(16)18/h1-3,5H,(H,15,17,18) |
| InChIKey | QULYPIHCCBNZGH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.99 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|