C13H8ClN3O3 — CID 107810702
3-chloro-4-(4,6,8-trioxo-5,7-diazaspiro[2.5]octan-7-yl)benzonitrile (PubChem CID 107810702) has the molecular formula C13H8ClN3O3 and a molecular weight of 289.68 g/mol. Its IUPAC name is 3-chloro-4-(4,6,8-trioxo-5,7-diazaspiro[2.5]octan-7-yl)benzonitrile.
| Compound Name | 3-chloro-4-(4,6,8-trioxo-5,7-diazaspiro[2.5]octan-7-yl)benzonitrile |
|---|---|
| PubChem CID | 107810702 |
| Molecular Formula | C13H8ClN3O3 |
| Molecular Weight | 289.68 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 3-chloro-4-(4,6,8-trioxo-5,7-diazaspiro[2.5]octan-7-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)NC(=O)C3(CC3)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C13H8ClN3O3/c14-8-5-7(6-15)1-2-9(8)17-11(19)13(3-4-13)10(18)16-12(17)20/h1-2,5H,3-4H2,(H,16,18,20) |
| InChIKey | RFVMUUWCHOVVRY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.68 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|