C15H14ClN3O2 — CID 102670451
3-chloro-4-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-1-yl)methyl]benzonitrile (PubChem CID 102670451) has the molecular formula C15H14ClN3O2 and a molecular weight of 303.75 g/mol. Its IUPAC name is 3-chloro-4-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-1-yl)methyl]benzonitrile.
| Compound Name | 3-chloro-4-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 102670451 |
| Molecular Formula | C15H14ClN3O2 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-chloro-4-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2C(=O)NC(=O)C23CCCC3)c(Cl)c1 |
| InChI | InChI=1S/C15H14ClN3O2/c16-12-7-10(8-17)3-4-11(12)9-19-14(21)18-13(20)15(19)5-1-2-6-15/h3-4,7H,1-2,5-6,9H2,(H,18,20,21) |
| InChIKey | YCPKZMYVNZNZCS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|