C15H18ClN3O2 — CID 102668978
2-[4-[(2-chloro-4-cyanophenyl)methyl]-1,4-diazepan-1-yl]acetic acid (PubChem CID 102668978) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 2-[4-[(2-chloro-4-cyanophenyl)methyl]-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-[(2-chloro-4-cyanophenyl)methyl]-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 102668978 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-[4-[(2-chloro-4-cyanophenyl)methyl]-1,4-diazepan-1-yl]acetic acid |
| SMILES | N#Cc1ccc(CN2CCCN(CC(=O)O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H18ClN3O2/c16-14-8-12(9-17)2-3-13(14)10-18-4-1-5-19(7-6-18)11-15(20)21/h2-3,8H,1,4-7,10-11H2,(H,20,21) |
| InChIKey | CUSNRRIYHUQWCC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |