C12H13ClN2O2 — CID 106669441
3-chloro-4-[(3,4-dihydroxypyrrolidin-1-yl)methyl]benzonitrile (PubChem CID 106669441) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 3-chloro-4-[(3,4-dihydroxypyrrolidin-1-yl)methyl]benzonitrile.
| Compound Name | 3-chloro-4-[(3,4-dihydroxypyrrolidin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 106669441 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-chloro-4-[(3,4-dihydroxypyrrolidin-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CC(O)C(O)C2)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2O2/c13-10-3-8(4-14)1-2-9(10)5-15-6-11(16)12(17)7-15/h1-3,11-12,16-17H,5-7H2 |
| InChIKey | GZRYKZPWIIEYOX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |