C15H17ClN2O — CID 102665626
3-chloro-4-[(2-oxoazocan-1-yl)methyl]benzonitrile (PubChem CID 102665626) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is 3-chloro-4-[(2-oxoazocan-1-yl)methyl]benzonitrile.
| Compound Name | 3-chloro-4-[(2-oxoazocan-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 102665626 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-chloro-4-[(2-oxoazocan-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCCCCCC2=O)c(Cl)c1 |
| InChI | InChI=1S/C15H17ClN2O/c16-14-9-12(10-17)6-7-13(14)11-18-8-4-2-1-3-5-15(18)19/h6-7,9H,1-5,8,11H2 |
| InChIKey | YQFXZUBESMLCCE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |