C15H11ClN2O2 — CID 104962986
3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-chlorobenzonitrile (PubChem CID 104962986) has the molecular formula C15H11ClN2O2 and a molecular weight of 286.72 g/mol. Its IUPAC name is 3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-chlorobenzonitrile.
| Compound Name | 3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-chlorobenzonitrile |
|---|---|
| PubChem CID | 104962986 |
| Molecular Formula | C15H11ClN2O2 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 3-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-4-chlorobenzonitrile |
| SMILES | N#Cc1ccc(Cl)c(N2C(=O)[C@H]3CC=CC[C@H]3C2=O)c1 |
| InChI | InChI=1S/C15H11ClN2O2/c16-12-6-5-9(8-17)7-13(12)18-14(19)10-3-1-2-4-11(10)15(18)20/h1-2,5-7,10-11H,3-4H2/t10-,11+ |
| InChIKey | FWWQTFIITYXAFZ-PHIMTYICSA-N |
| XLogP | 2.67 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|