C14H10Cl3NO2 — CID 53231773
(3aR,7aS)-2-(3,4,5-trichlorophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 53231773) has the molecular formula C14H10Cl3NO2 and a molecular weight of 330.60 g/mol. Its IUPAC name is (3aR,7aS)-2-(3,4,5-trichlorophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-2-(3,4,5-trichlorophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 53231773 |
| Molecular Formula | C14H10Cl3NO2 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | (3aR,7aS)-2-(3,4,5-trichlorophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CC=CC[C@H]2C(=O)N1c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl3NO2/c15-10-5-7(6-11(16)12(10)17)18-13(19)8-3-1-2-4-9(8)14(18)20/h1-2,5-6,8-9H,3-4H2/t8-,9+ |
| InChIKey | UQGZLTPPVYCJEA-DTORHVGOSA-N |
| XLogP | 4.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|