C16H12Cl3NO3 — CID 68543423
4-(3,4,5-trichlorophenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione (PubChem CID 68543423) has the molecular formula C16H12Cl3NO3 and a molecular weight of 372.64 g/mol. Its IUPAC name is 4-(3,4,5-trichlorophenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione.
| Compound Name | 4-(3,4,5-trichlorophenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
|---|---|
| PubChem CID | 68543423 |
| Molecular Formula | C16H12Cl3NO3 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 4-(3,4,5-trichlorophenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
| SMILES | O=C1CC2CCC1C1C(=O)N(c3cc(Cl)c(Cl)c(Cl)c3)C(=O)C21 |
| InChI | InChI=1S/C16H12Cl3NO3/c17-9-4-7(5-10(18)14(9)19)20-15(22)12-6-1-2-8(11(21)3-6)13(12)16(20)23/h4-6,8,12-13H,1-3H2 |
| InChIKey | CNAAMTLYZXVCJR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|