C18H13F6NO3 — CID 87912689
(1R,2S,6R,7R)-4-[3,5-bis(trifluoromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione (PubChem CID 87912689) has the molecular formula C18H13F6NO3 and a molecular weight of 405.29 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-[3,5-bis(trifluoromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione.
| Compound Name | (1R,2S,6R,7R)-4-[3,5-bis(trifluoromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
|---|---|
| PubChem CID | 87912689 |
| Molecular Formula | C18H13F6NO3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | (1R,2S,6R,7R)-4-[3,5-bis(trifluoromethyl)phenyl]-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
| SMILES | O=C1C[C@H]2CC[C@@H]1[C@H]1C(=O)N(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C18H13F6NO3/c19-17(20,21)8-4-9(18(22,23)24)6-10(5-8)25-15(27)13-7-1-2-11(12(26)3-7)14(13)16(25)28/h4-7,11,13-14H,1-3H2/t7-,11+,13+,14-/m1/s1 |
| InChIKey | YVMGORSPQCKZPY-TZUYWYFRSA-N |
| XLogP | 3.83 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|