C16H14ClNO3 — CID 68542054
4-(3-chlorophenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione (PubChem CID 68542054) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione.
| Compound Name | 4-(3-chlorophenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
|---|---|
| PubChem CID | 68542054 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-(3-chlorophenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
| SMILES | O=C1CC2CCC1C1C(=O)N(c3cccc(Cl)c3)C(=O)C21 |
| InChI | InChI=1S/C16H14ClNO3/c17-9-2-1-3-10(7-9)18-15(20)13-8-4-5-11(12(19)6-8)14(13)16(18)21/h1-3,7-8,11,13-14H,4-6H2 |
| InChIKey | QVVZCKJBGIYTCW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|