C17H16FNO3 — CID 68542436
4-(3-fluoro-4-methylphenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione (PubChem CID 68542436) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is 4-(3-fluoro-4-methylphenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione.
| Compound Name | 4-(3-fluoro-4-methylphenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
|---|---|
| PubChem CID | 68542436 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4-(3-fluoro-4-methylphenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
| SMILES | Cc1ccc(N2C(=O)C3C4CCC(C(=O)C4)C3C2=O)cc1F |
| InChI | InChI=1S/C17H16FNO3/c1-8-2-4-10(7-12(8)18)19-16(21)14-9-3-5-11(13(20)6-9)15(14)17(19)22/h2,4,7,9,11,14-15H,3,5-6H2,1H3 |
| InChIKey | MBHQBBVCWCSIIA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|