C16H13F2NO3 — CID 68547365
4-(3,4-difluorophenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione (PubChem CID 68547365) has the molecular formula C16H13F2NO3 and a molecular weight of 305.28 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione.
| Compound Name | 4-(3,4-difluorophenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
|---|---|
| PubChem CID | 68547365 |
| Molecular Formula | C16H13F2NO3 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-(3,4-difluorophenyl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
| SMILES | O=C1CC2CCC1C1C(=O)N(c3ccc(F)c(F)c3)C(=O)C21 |
| InChI | InChI=1S/C16H13F2NO3/c17-10-4-2-8(6-11(10)18)19-15(21)13-7-1-3-9(12(20)5-7)14(13)16(19)22/h2,4,6-7,9,13-14H,1,3,5H2 |
| InChIKey | HDJVUDQOOQHUGC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|