C12H10ClFN2O3 — CID 107531960
1-(2-chloro-5-fluorophenyl)-5,5-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 107531960) has the molecular formula C12H10ClFN2O3 and a molecular weight of 284.67 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-5,5-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-5,5-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 107531960 |
| Molecular Formula | C12H10ClFN2O3 |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-5,5-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC1(C)C(=O)NC(=O)N(c2cc(F)ccc2Cl)C1=O |
| InChI | InChI=1S/C12H10ClFN2O3/c1-12(2)9(17)15-11(19)16(10(12)18)8-5-6(14)3-4-7(8)13/h3-5H,1-2H3,(H,15,17,19) |
| InChIKey | KWKAXQGLEFYHIO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|