C10H8ClN3 — CID 149160761
1-(3-chlorophenyl)pyrrole-2,5-diimine (PubChem CID 149160761) has the molecular formula C10H8ClN3 and a molecular weight of 205.65 g/mol. Its IUPAC name is 1-(3-chlorophenyl)pyrrole-2,5-diimine.
| Compound Name | 1-(3-chlorophenyl)pyrrole-2,5-diimine |
|---|---|
| PubChem CID | 149160761 |
| Molecular Formula | C10H8ClN3 |
| Molecular Weight | 205.65 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 1-(3-chlorophenyl)pyrrole-2,5-diimine |
| SMILES | [H]/N=C1\C=C/C(=N\[H])N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H8ClN3/c11-7-2-1-3-8(6-7)14-9(12)4-5-10(14)13/h1-6,12-13H/b12-9+,13-10+ |
| InChIKey | VACPSXOZRALSGC-JOWSBRCASA-N |
| XLogP | 2.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.65 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|