C17H12Cl2N2O2 — CID 171843838
5,6-bis(3-chlorophenyl)-5,6-diazaspiro[2.4]heptane-4,7-dione (PubChem CID 171843838) has the molecular formula C17H12Cl2N2O2 and a molecular weight of 347.20 g/mol. Its IUPAC name is 5,6-bis(3-chlorophenyl)-5,6-diazaspiro[2.4]heptane-4,7-dione.
| Compound Name | 5,6-bis(3-chlorophenyl)-5,6-diazaspiro[2.4]heptane-4,7-dione |
|---|---|
| PubChem CID | 171843838 |
| Molecular Formula | C17H12Cl2N2O2 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 5,6-bis(3-chlorophenyl)-5,6-diazaspiro[2.4]heptane-4,7-dione |
| SMILES | O=C1N(c2cccc(Cl)c2)N(c2cccc(Cl)c2)C(=O)C12CC2 |
| InChI | InChI=1S/C17H12Cl2N2O2/c18-11-3-1-5-13(9-11)20-15(22)17(7-8-17)16(23)21(20)14-6-2-4-12(19)10-14/h1-6,9-10H,7-8H2 |
| InChIKey | SWCYHMPDIKOXDR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|