C10H8ClF2NO2 — CID 58238342
(4S)-1-(3-chlorophenyl)-3,3-difluoro-4-hydroxypyrrolidin-2-one (PubChem CID 58238342) has the molecular formula C10H8ClF2NO2 and a molecular weight of 247.63 g/mol. Its IUPAC name is (4S)-1-(3-chlorophenyl)-3,3-difluoro-4-hydroxypyrrolidin-2-one.
| Compound Name | (4S)-1-(3-chlorophenyl)-3,3-difluoro-4-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 58238342 |
| Molecular Formula | C10H8ClF2NO2 |
| Molecular Weight | 247.63 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | (4S)-1-(3-chlorophenyl)-3,3-difluoro-4-hydroxypyrrolidin-2-one |
| SMILES | O=C1N(c2cccc(Cl)c2)C[C@H](O)C1(F)F |
| InChI | InChI=1S/C10H8ClF2NO2/c11-6-2-1-3-7(4-6)14-5-8(15)10(12,13)9(14)16/h1-4,8,15H,5H2/t8-/m0/s1 |
| InChIKey | KWPYRDAFARKJFK-QMMMGPOBSA-N |
| XLogP | 1.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.63 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |