C12H16ClNO — CID 117016836
1-(3-chlorophenyl)-2,2-dimethylpyrrolidin-3-ol (PubChem CID 117016836) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2,2-dimethylpyrrolidin-3-ol.
| Compound Name | 1-(3-chlorophenyl)-2,2-dimethylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 117016836 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1-(3-chlorophenyl)-2,2-dimethylpyrrolidin-3-ol |
| SMILES | CC1(C)C(O)CCN1c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO/c1-12(2)11(15)6-7-14(12)10-5-3-4-9(13)8-10/h3-5,8,11,15H,6-7H2,1-2H3 |
| InChIKey | YYSDZVMJEIZHJA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |