C14H20ClNO — CID 117019064
1-(5-chloro-2-methylphenyl)-2,2-dimethylpiperidin-3-ol (PubChem CID 117019064) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-2,2-dimethylpiperidin-3-ol.
| Compound Name | 1-(5-chloro-2-methylphenyl)-2,2-dimethylpiperidin-3-ol |
|---|---|
| PubChem CID | 117019064 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-2,2-dimethylpiperidin-3-ol |
| SMILES | Cc1ccc(Cl)cc1N1CCCC(O)C1(C)C |
| InChI | InChI=1S/C14H20ClNO/c1-10-6-7-11(15)9-12(10)16-8-4-5-13(17)14(16,2)3/h6-7,9,13,17H,4-5,8H2,1-3H3 |
| InChIKey | WJODIHQZVGNREI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |