C16H16ClF3N2O2 — CID 171676116
1-(3-chlorophenyl)-4-[1-(trifluoromethyl)cyclobutanecarbonyl]piperazin-2-one (PubChem CID 171676116) has the molecular formula C16H16ClF3N2O2 and a molecular weight of 360.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[1-(trifluoromethyl)cyclobutanecarbonyl]piperazin-2-one.
| Compound Name | 1-(3-chlorophenyl)-4-[1-(trifluoromethyl)cyclobutanecarbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 171676116 |
| Molecular Formula | C16H16ClF3N2O2 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[1-(trifluoromethyl)cyclobutanecarbonyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)C2(C(F)(F)F)CCC2)CCN1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClF3N2O2/c17-11-3-1-4-12(9-11)22-8-7-21(10-13(22)23)14(24)15(5-2-6-15)16(18,19)20/h1,3-4,9H,2,5-8,10H2 |
| InChIKey | FWMXNUJTZPGALC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |