C19H19ClN2O4 — CID 96576006
4-[(2R)-2-(2-chlorophenyl)-2-hydroxyacetyl]-1-(3-methoxyphenyl)piperazin-2-one (PubChem CID 96576006) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is 4-[(2R)-2-(2-chlorophenyl)-2-hydroxyacetyl]-1-(3-methoxyphenyl)piperazin-2-one.
| Compound Name | 4-[(2R)-2-(2-chlorophenyl)-2-hydroxyacetyl]-1-(3-methoxyphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 96576006 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-[(2R)-2-(2-chlorophenyl)-2-hydroxyacetyl]-1-(3-methoxyphenyl)piperazin-2-one |
| SMILES | COc1cccc(N2CCN(C(=O)[C@H](O)c3ccccc3Cl)CC2=O)c1 |
| InChI | InChI=1S/C19H19ClN2O4/c1-26-14-6-4-5-13(11-14)22-10-9-21(12-17(22)23)19(25)18(24)15-7-2-3-8-16(15)20/h2-8,11,18,24H,9-10,12H2,1H3/t18-/m1/s1 |
| InChIKey | MXDTVQXITVJRJS-GOSISDBHSA-N |
| XLogP | 2.26 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |