C20H29N3O3 — CID 97188104
1-(3-methoxyphenyl)-4-[3-[(2R)-1-methylpiperidin-2-yl]propanoyl]piperazin-2-one (PubChem CID 97188104) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-4-[3-[(2R)-1-methylpiperidin-2-yl]propanoyl]piperazin-2-one.
| Compound Name | 1-(3-methoxyphenyl)-4-[3-[(2R)-1-methylpiperidin-2-yl]propanoyl]piperazin-2-one |
|---|---|
| PubChem CID | 97188104 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 1-(3-methoxyphenyl)-4-[3-[(2R)-1-methylpiperidin-2-yl]propanoyl]piperazin-2-one |
| SMILES | COc1cccc(N2CCN(C(=O)CC[C@H]3CCCCN3C)CC2=O)c1 |
| InChI | InChI=1S/C20H29N3O3/c1-21-11-4-3-6-16(21)9-10-19(24)22-12-13-23(20(25)15-22)17-7-5-8-18(14-17)26-2/h5,7-8,14,16H,3-4,6,9-13,15H2,1-2H3/t16-/m1/s1 |
| InChIKey | YQSGMQRFSXOGHN-MRXNPFEDSA-N |
| XLogP | 2.13 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |