C19H26N2O5 — CID 96572161
1-(3-methoxyphenyl)-4-[2-[[(2R)-oxan-2-yl]methoxy]acetyl]piperazin-2-one (PubChem CID 96572161) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-4-[2-[[(2R)-oxan-2-yl]methoxy]acetyl]piperazin-2-one.
| Compound Name | 1-(3-methoxyphenyl)-4-[2-[[(2R)-oxan-2-yl]methoxy]acetyl]piperazin-2-one |
|---|---|
| PubChem CID | 96572161 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-(3-methoxyphenyl)-4-[2-[[(2R)-oxan-2-yl]methoxy]acetyl]piperazin-2-one |
| SMILES | COc1cccc(N2CCN(C(=O)COC[C@H]3CCCCO3)CC2=O)c1 |
| InChI | InChI=1S/C19H26N2O5/c1-24-16-7-4-5-15(11-16)21-9-8-20(12-18(21)22)19(23)14-25-13-17-6-2-3-10-26-17/h4-5,7,11,17H,2-3,6,8-10,12-14H2,1H3/t17-/m1/s1 |
| InChIKey | YYPULVRRNMAWGK-QGZVFWFLSA-N |
| XLogP | 1.46 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |