C19H21N3O5 — CID 72901150
4-[2-(3-methoxy-2-oxo-1-pyridinyl)acetyl]-1-(3-methoxyphenyl)piperazin-2-one (PubChem CID 72901150) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 4-[2-(3-methoxy-2-oxo-1-pyridinyl)acetyl]-1-(3-methoxyphenyl)piperazin-2-one.
| Compound Name | 4-[2-(3-methoxy-2-oxo-1-pyridinyl)acetyl]-1-(3-methoxyphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 72901150 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-[2-(3-methoxy-2-oxo-1-pyridinyl)acetyl]-1-(3-methoxyphenyl)piperazin-2-one |
| SMILES | COc1cccc(N2CCN(C(=O)Cn3cccc(OC)c3=O)CC2=O)c1 |
| InChI | InChI=1S/C19H21N3O5/c1-26-15-6-3-5-14(11-15)22-10-9-20(13-18(22)24)17(23)12-21-8-4-7-16(27-2)19(21)25/h3-8,11H,9-10,12-13H2,1-2H3 |
| InChIKey | NHNSSCGHFFBUJP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |