C12H16N2O3S — CID 72931086
3-methoxy-1-(2-oxo-2-thiomorpholin-4-ylethyl)pyridin-2-one (PubChem CID 72931086) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 3-methoxy-1-(2-oxo-2-thiomorpholin-4-ylethyl)pyridin-2-one.
| Compound Name | 3-methoxy-1-(2-oxo-2-thiomorpholin-4-ylethyl)pyridin-2-one |
|---|---|
| PubChem CID | 72931086 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 3-methoxy-1-(2-oxo-2-thiomorpholin-4-ylethyl)pyridin-2-one |
| SMILES | COc1cccn(CC(=O)N2CCSCC2)c1=O |
| InChI | InChI=1S/C12H16N2O3S/c1-17-10-3-2-4-14(12(10)16)9-11(15)13-5-7-18-8-6-13/h2-4H,5-9H2,1H3 |
| InChIKey | JONYMGQBNBDJDQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |