C16H24N2O4 — CID 97283444
3-methoxy-1-[2-oxo-2-[(3S)-3-(propoxymethyl)pyrrolidin-1-yl]ethyl]pyridin-2-one (PubChem CID 97283444) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-methoxy-1-[2-oxo-2-[(3S)-3-(propoxymethyl)pyrrolidin-1-yl]ethyl]pyridin-2-one.
| Compound Name | 3-methoxy-1-[2-oxo-2-[(3S)-3-(propoxymethyl)pyrrolidin-1-yl]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 97283444 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-methoxy-1-[2-oxo-2-[(3S)-3-(propoxymethyl)pyrrolidin-1-yl]ethyl]pyridin-2-one |
| SMILES | CCCOC[C@H]1CCN(C(=O)Cn2cccc(OC)c2=O)C1 |
| InChI | InChI=1S/C16H24N2O4/c1-3-9-22-12-13-6-8-17(10-13)15(19)11-18-7-4-5-14(21-2)16(18)20/h4-5,7,13H,3,6,8-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | UMWJOPBWPBWDBX-ZDUSSCGKSA-N |
| XLogP | 1.13 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|