C14H21N3O4 — CID 97284852
1-[2-[(2S)-2-(2-aminoethyl)morpholin-4-yl]-2-oxoethyl]-3-methoxypyridin-2-one (PubChem CID 97284852) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-[2-[(2S)-2-(2-aminoethyl)morpholin-4-yl]-2-oxoethyl]-3-methoxypyridin-2-one.
| Compound Name | 1-[2-[(2S)-2-(2-aminoethyl)morpholin-4-yl]-2-oxoethyl]-3-methoxypyridin-2-one |
|---|---|
| PubChem CID | 97284852 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-[2-[(2S)-2-(2-aminoethyl)morpholin-4-yl]-2-oxoethyl]-3-methoxypyridin-2-one |
| SMILES | COc1cccn(CC(=O)N2CCO[C@@H](CCN)C2)c1=O |
| InChI | InChI=1S/C14H21N3O4/c1-20-12-3-2-6-17(14(12)19)10-13(18)16-7-8-21-11(9-16)4-5-15/h2-3,6,11H,4-5,7-10,15H2,1H3/t11-/m0/s1 |
| InChIKey | ZGTOIITVAASGEJ-NSHDSACASA-N |
| XLogP | -0.57 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |