C15H22N2O4 — CID 97280486
2-(3-methoxy-2-oxo-1-pyridinyl)-N-methyl-N-[[(2R)-oxan-2-yl]methyl]acetamide (PubChem CID 97280486) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-(3-methoxy-2-oxo-1-pyridinyl)-N-methyl-N-[[(2R)-oxan-2-yl]methyl]acetamide.
| Compound Name | 2-(3-methoxy-2-oxo-1-pyridinyl)-N-methyl-N-[[(2R)-oxan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 97280486 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-(3-methoxy-2-oxo-1-pyridinyl)-N-methyl-N-[[(2R)-oxan-2-yl]methyl]acetamide |
| SMILES | COc1cccn(CC(=O)N(C)C[C@H]2CCCCO2)c1=O |
| InChI | InChI=1S/C15H22N2O4/c1-16(10-12-6-3-4-9-21-12)14(18)11-17-8-5-7-13(20-2)15(17)19/h5,7-8,12H,3-4,6,9-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | DFFSALZXRXQYJD-GFCCVEGCSA-N |
| XLogP | 0.88 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |