C17H24N2O4 — CID 72884824
3-methoxy-1-[2-(9-oxa-2-azaspiro[5.5]undecan-2-yl)-2-oxoethyl]pyridin-2-one (PubChem CID 72884824) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-methoxy-1-[2-(9-oxa-2-azaspiro[5.5]undecan-2-yl)-2-oxoethyl]pyridin-2-one.
| Compound Name | 3-methoxy-1-[2-(9-oxa-2-azaspiro[5.5]undecan-2-yl)-2-oxoethyl]pyridin-2-one |
|---|---|
| PubChem CID | 72884824 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 3-methoxy-1-[2-(9-oxa-2-azaspiro[5.5]undecan-2-yl)-2-oxoethyl]pyridin-2-one |
| SMILES | COc1cccn(CC(=O)N2CCCC3(CCOCC3)C2)c1=O |
| InChI | InChI=1S/C17H24N2O4/c1-22-14-4-2-8-18(16(14)21)12-15(20)19-9-3-5-17(13-19)6-10-23-11-7-17/h2,4,8H,3,5-7,9-13H2,1H3 |
| InChIKey | XRNMIOFZOYEZHT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |