C17H24N2O5 — CID 124754048
1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-[[(2S)-oxan-2-yl]methoxy]ethanone (PubChem CID 124754048) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-[[(2S)-oxan-2-yl]methoxy]ethanone.
| Compound Name | 1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-[[(2S)-oxan-2-yl]methoxy]ethanone |
|---|---|
| PubChem CID | 124754048 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-[[(2S)-oxan-2-yl]methoxy]ethanone |
| SMILES | O=C(COC[C@@H]1CCCCO1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C17H24N2O5/c20-16(13-22-12-14-4-1-2-10-23-14)18-6-8-19(9-7-18)17(21)15-5-3-11-24-15/h3,5,11,14H,1-2,4,6-10,12-13H2/t14-/m0/s1 |
| InChIKey | NEVAPJJPMNZDDA-AWEZNQCLSA-N |
| XLogP | 1.15 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |