C20H29NO4 — CID 70729669
2-(oxan-2-ylmethoxy)-1-(4-phenylmethoxypiperidin-1-yl)ethanone (PubChem CID 70729669) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is 2-(oxan-2-ylmethoxy)-1-(4-phenylmethoxypiperidin-1-yl)ethanone.
| Compound Name | 2-(oxan-2-ylmethoxy)-1-(4-phenylmethoxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 70729669 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-(oxan-2-ylmethoxy)-1-(4-phenylmethoxypiperidin-1-yl)ethanone |
| SMILES | O=C(COCC1CCCCO1)N1CCC(OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H29NO4/c22-20(16-23-15-19-8-4-5-13-24-19)21-11-9-18(10-12-21)25-14-17-6-2-1-3-7-17/h1-3,6-7,18-19H,4-5,8-16H2 |
| InChIKey | RYCKZVFMHHMZIX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |