C16H20ClNO4 — CID 124588553
1-[3-(2-chlorophenoxy)azetidin-1-yl]-2-[[(2R)-oxolan-2-yl]methoxy]ethanone (PubChem CID 124588553) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is 1-[3-(2-chlorophenoxy)azetidin-1-yl]-2-[[(2R)-oxolan-2-yl]methoxy]ethanone.
| Compound Name | 1-[3-(2-chlorophenoxy)azetidin-1-yl]-2-[[(2R)-oxolan-2-yl]methoxy]ethanone |
|---|---|
| PubChem CID | 124588553 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-[3-(2-chlorophenoxy)azetidin-1-yl]-2-[[(2R)-oxolan-2-yl]methoxy]ethanone |
| SMILES | O=C(COC[C@H]1CCCO1)N1CC(Oc2ccccc2Cl)C1 |
| InChI | InChI=1S/C16H20ClNO4/c17-14-5-1-2-6-15(14)22-13-8-18(9-13)16(19)11-20-10-12-4-3-7-21-12/h1-2,5-6,12-13H,3-4,7-11H2/t12-/m1/s1 |
| InChIKey | LWESUDCKQHIOJE-GFCCVEGCSA-N |
| XLogP | 2.13 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |