C17H22FNO3 — CID 95598403
1-[(3R)-3-(3-fluorophenyl)pyrrolidin-1-yl]-2-[[(2S)-oxolan-2-yl]methoxy]ethanone (PubChem CID 95598403) has the molecular formula C17H22FNO3 and a molecular weight of 307.36 g/mol. Its IUPAC name is 1-[(3R)-3-(3-fluorophenyl)pyrrolidin-1-yl]-2-[[(2S)-oxolan-2-yl]methoxy]ethanone.
| Compound Name | 1-[(3R)-3-(3-fluorophenyl)pyrrolidin-1-yl]-2-[[(2S)-oxolan-2-yl]methoxy]ethanone |
|---|---|
| PubChem CID | 95598403 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-[(3R)-3-(3-fluorophenyl)pyrrolidin-1-yl]-2-[[(2S)-oxolan-2-yl]methoxy]ethanone |
| SMILES | O=C(COC[C@@H]1CCCO1)N1CC[C@H](c2cccc(F)c2)C1 |
| InChI | InChI=1S/C17H22FNO3/c18-15-4-1-3-13(9-15)14-6-7-19(10-14)17(20)12-21-11-16-5-2-8-22-16/h1,3-4,9,14,16H,2,5-8,10-12H2/t14-,16-/m0/s1 |
| InChIKey | NRGGAYVVAIRUAG-HOCLYGCPSA-N |
| XLogP | 2.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |