C26H29F3O4 — CID 142540594
bis((3-fluorophenyl)methanol);(2S)-2-[(3-fluorophenyl)methoxymethyl]oxolane (PubChem CID 142540594) has the molecular formula C26H29F3O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is bis((3-fluorophenyl)methanol);(2S)-2-[(3-fluorophenyl)methoxymethyl]oxolane.
| Compound Name | bis((3-fluorophenyl)methanol);(2S)-2-[(3-fluorophenyl)methoxymethyl]oxolane |
|---|---|
| PubChem CID | 142540594 |
| Molecular Formula | C26H29F3O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | bis((3-fluorophenyl)methanol);(2S)-2-[(3-fluorophenyl)methoxymethyl]oxolane |
| SMILES | Fc1cccc(COC[C@@H]2CCCO2)c1.OCc1cccc(F)c1.OCc1cccc(F)c1 |
| InChI | InChI=1S/C12H15FO2.2C7H7FO/c13-11-4-1-3-10(7-11)8-14-9-12-5-2-6-15-12;2*8-7-3-1-2-6(4-7)5-9/h1,3-4,7,12H,2,5-6,8-9H2;2*1-4,9H,5H2/t12-;;/m0../s1 |
| InChIKey | SEBPFQZOYZDIIC-LTCKWSDVSA-N |
| XLogP | 5.16 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |