C20H29NO4 — CID 97418282
[(3S)-3-(cyclopentylmethoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-(furan-2-yl)methanone (PubChem CID 97418282) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(3S)-3-(cyclopentylmethoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-(furan-2-yl)methanone.
| Compound Name | [(3S)-3-(cyclopentylmethoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 97418282 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [(3S)-3-(cyclopentylmethoxymethyl)-2-oxa-8-azaspiro[4.5]decan-8-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCC2(CC1)CO[C@H](COCC1CCCC1)C2 |
| InChI | InChI=1S/C20H29NO4/c22-19(18-6-3-11-24-18)21-9-7-20(8-10-21)12-17(25-15-20)14-23-13-16-4-1-2-5-16/h3,6,11,16-17H,1-2,4-5,7-10,12-15H2/t17-/m0/s1 |
| InChIKey | CYYIYYYZSDNJGJ-KRWDZBQOSA-N |
| XLogP | 3.50 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |