C19H31IN4O4 — CID 111167716
4-(furan-2-carbonyl)-N'-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111167716) has the molecular formula C19H31IN4O4 and a molecular weight of 506.39 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(furan-2-carbonyl)-N'-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111167716 |
| Molecular Formula | C19H31IN4O4 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-methyl-N-[3-(oxolan-2-ylmethoxy)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCCO1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C19H30N4O4.HI/c1-20-19(21-7-4-12-25-15-16-5-2-13-26-16)23-10-8-22(9-11-23)18(24)17-6-3-14-27-17;/h3,6,14,16H,2,4-5,7-13,15H2,1H3,(H,20,21);1H |
| InChIKey | AKNKCSJLDTUNGJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|