C23H30N4O3 — CID 111166065
4-(furan-2-carbonyl)-N'-methyl-N-[(2-phenyloxan-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111166065) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-methyl-N-[(2-phenyloxan-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(furan-2-carbonyl)-N'-methyl-N-[(2-phenyloxan-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111166065 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-methyl-N-[(2-phenyloxan-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CCCOC1c1ccccc1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C23H30N4O3/c1-24-23(27-13-11-26(12-14-27)22(28)20-10-6-15-29-20)25-17-19-9-5-16-30-21(19)18-7-3-2-4-8-18/h2-4,6-8,10,15,19,21H,5,9,11-14,16-17H2,1H3,(H,24,25) |
| InChIKey | ZTOMWQOEVQIUBP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|