C24H33IN4O3 — CID 111166486
N-ethyl-4-(furan-2-carbonyl)-N'-[(2-phenyloxan-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111166486) has the molecular formula C24H33IN4O3 and a molecular weight of 552.46 g/mol. Its IUPAC name is N-ethyl-4-(furan-2-carbonyl)-N'-[(2-phenyloxan-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(furan-2-carbonyl)-N'-[(2-phenyloxan-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111166486 |
| Molecular Formula | C24H33IN4O3 |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | N-ethyl-4-(furan-2-carbonyl)-N'-[(2-phenyloxan-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCOC1c1ccccc1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C24H32N4O3.HI/c1-2-25-24(28-14-12-27(13-15-28)23(29)21-11-7-16-30-21)26-18-20-10-6-17-31-22(20)19-8-4-3-5-9-19;/h3-5,7-9,11,16,20,22H,2,6,10,12-15,17-18H2,1H3,(H,25,26);1H |
| InChIKey | JBMCQFKNDMRHJV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|