C20H33N5O3 — CID 111166111
4-(furan-2-carbonyl)-N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]piperazine-1-carboximidamide (PubChem CID 111166111) has the molecular formula C20H33N5O3 and a molecular weight of 391.52 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(furan-2-carbonyl)-N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111166111 |
| Molecular Formula | C20H33N5O3 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CN(CC(C)C)CCO1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H33N5O3/c1-16(2)14-23-10-12-27-17(15-23)13-22-20(21-3)25-8-6-24(7-9-25)19(26)18-5-4-11-28-18/h4-5,11,16-17H,6-10,12-15H2,1-3H3,(H,21,22) |
| InChIKey | BHTMWBGPUBKNPE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|