C22H38IN5O2 — CID 111290680
4-(3-methoxyphenyl)-N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111290680) has the molecular formula C22H38IN5O2 and a molecular weight of 531.48 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-methoxyphenyl)-N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111290680 |
| Molecular Formula | C22H38IN5O2 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 4-(3-methoxyphenyl)-N'-methyl-N-[[4-(2-methylpropyl)morpholin-2-yl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC1CN(CC(C)C)CCO1)N1CCN(c2cccc(OC)c2)CC1.I |
| InChI | InChI=1S/C22H37N5O2.HI/c1-18(2)16-25-12-13-29-21(17-25)15-24-22(23-3)27-10-8-26(9-11-27)19-6-5-7-20(14-19)28-4;/h5-7,14,18,21H,8-13,15-17H2,1-4H3,(H,23,24);1H |
| InChIKey | QMGDOGKGORIAJO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|