C22H31IN4O3 — CID 111620211
N-[2-[[N'-methyl-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111620211) has the molecular formula C22H31IN4O3 and a molecular weight of 526.42 g/mol. Its IUPAC name is N-[2-[[N'-methyl-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-methyl-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111620211 |
| Molecular Formula | C22H31IN4O3 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | N-[2-[[N'-methyl-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1ccco1)NCC1CCCOC1c1ccc(C)cc1.I |
| InChI | InChI=1S/C22H30N4O3.HI/c1-16-7-9-17(10-8-16)20-18(5-3-14-29-20)15-26-22(23-2)25-12-11-24-21(27)19-6-4-13-28-19;/h4,6-10,13,18,20H,3,5,11-12,14-15H2,1-2H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | HLZXXGRXMKCUTP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|