C18H27F3IN3O — CID 111987232
2-methyl-1-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111987232) has the molecular formula C18H27F3IN3O and a molecular weight of 485.33 g/mol. Its IUPAC name is 2-methyl-1-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111987232 |
| Molecular Formula | C18H27F3IN3O |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 2-methyl-1-[[2-(4-methylphenyl)oxan-3-yl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCC1CCCOC1c1ccc(C)cc1.I |
| InChI | InChI=1S/C18H26F3N3O.HI/c1-13-5-7-14(8-6-13)16-15(4-3-11-25-16)12-24-17(22-2)23-10-9-18(19,20)21;/h5-8,15-16H,3-4,9-12H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | DSBPEQSHXVFAPA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|