C23H31N3O — CID 111620244
2-methyl-1-[(2-methylphenyl)methyl]-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine (PubChem CID 111620244) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is 2-methyl-1-[(2-methylphenyl)methyl]-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine.
| Compound Name | 2-methyl-1-[(2-methylphenyl)methyl]-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111620244 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 2-methyl-1-[(2-methylphenyl)methyl]-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccccc1C)NCC1CCCOC1c1ccc(C)cc1 |
| InChI | InChI=1S/C23H31N3O/c1-17-10-12-19(13-11-17)22-21(9-6-14-27-22)16-26-23(24-3)25-15-20-8-5-4-7-18(20)2/h4-5,7-8,10-13,21-22H,6,9,14-16H2,1-3H3,(H2,24,25,26) |
| InChIKey | GFWRKIJWFINJEM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|