C23H29F2N3O2 — CID 111619904
1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine (PubChem CID 111619904) has the molecular formula C23H29F2N3O2 and a molecular weight of 417.50 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111619904 |
| Molecular Formula | C23H29F2N3O2 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccccc1OC(F)F)NCC1CCCOC1c1ccc(C)cc1 |
| InChI | InChI=1S/C23H29F2N3O2/c1-16-9-11-17(12-10-16)21-19(7-5-13-29-21)15-28-23(26-2)27-14-18-6-3-4-8-20(18)30-22(24)25/h3-4,6,8-12,19,21-22H,5,7,13-15H2,1-2H3,(H2,26,27,28) |
| InChIKey | ARVGBBBMAQHFBW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|