C24H34N4O — CID 111620306
1-(3-anilinopropyl)-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine (PubChem CID 111620306) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine.
| Compound Name | 1-(3-anilinopropyl)-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111620306 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 1-(3-anilinopropyl)-2-methyl-3-[[2-(4-methylphenyl)oxan-3-yl]methyl]guanidine |
| SMILES | C/N=C(\NCCCNc1ccccc1)NCC1CCCOC1c1ccc(C)cc1 |
| InChI | InChI=1S/C24H34N4O/c1-19-11-13-20(14-12-19)23-21(8-6-17-29-23)18-28-24(25-2)27-16-7-15-26-22-9-4-3-5-10-22/h3-5,9-14,21,23,26H,6-8,15-18H2,1-2H3,(H2,25,27,28) |
| InChIKey | KOOFKSNAWPPEOT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|