C26H36N4O2 — CID 111619456
2-methyl-N-[4-[[[N'-methyl-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]methyl]phenyl]propanamide (PubChem CID 111619456) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 2-methyl-N-[4-[[[N'-methyl-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]methyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[[[N'-methyl-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 111619456 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 2-methyl-N-[4-[[[N'-methyl-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]methyl]phenyl]propanamide |
| SMILES | C/N=C(\NCc1ccc(NC(=O)C(C)C)cc1)NCC1CCCOC1c1ccc(C)cc1 |
| InChI | InChI=1S/C26H36N4O2/c1-18(2)25(31)30-23-13-9-20(10-14-23)16-28-26(27-4)29-17-22-6-5-15-32-24(22)21-11-7-19(3)8-12-21/h7-14,18,22,24H,5-6,15-17H2,1-4H3,(H,30,31)(H2,27,28,29) |
| InChIKey | OOVXKOMULFMFLO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|