C25H34N4O2 — CID 111620772
N-[4-[2-[[N'-methyl-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]ethyl]phenyl]acetamide (PubChem CID 111620772) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[4-[2-[[N'-methyl-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]ethyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[[N'-methyl-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 111620772 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | N-[4-[2-[[N'-methyl-N-[[2-(4-methylphenyl)oxan-3-yl]methyl]carbamimidoyl]amino]ethyl]phenyl]acetamide |
| SMILES | C/N=C(\NCCc1ccc(NC(C)=O)cc1)NCC1CCCOC1c1ccc(C)cc1 |
| InChI | InChI=1S/C25H34N4O2/c1-18-6-10-21(11-7-18)24-22(5-4-16-31-24)17-28-25(26-3)27-15-14-20-8-12-23(13-9-20)29-19(2)30/h6-13,22,24H,4-5,14-17H2,1-3H3,(H,29,30)(H2,26,27,28) |
| InChIKey | JCMIHSYEZIQWNU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|