C22H28ClN3O — CID 111196830
1-[2-(4-chlorophenyl)ethyl]-2-methyl-3-[(2-phenyloxan-3-yl)methyl]guanidine (PubChem CID 111196830) has the molecular formula C22H28ClN3O and a molecular weight of 385.94 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-2-methyl-3-[(2-phenyloxan-3-yl)methyl]guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-2-methyl-3-[(2-phenyloxan-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111196830 |
| Molecular Formula | C22H28ClN3O |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-2-methyl-3-[(2-phenyloxan-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCCc1ccc(Cl)cc1)NCC1CCCOC1c1ccccc1 |
| InChI | InChI=1S/C22H28ClN3O/c1-24-22(25-14-13-17-9-11-20(23)12-10-17)26-16-19-8-5-15-27-21(19)18-6-3-2-4-7-18/h2-4,6-7,9-12,19,21H,5,8,13-16H2,1H3,(H2,24,25,26) |
| InChIKey | CKAJRVCYBHDERS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|